BD0953632
2-Chloro-5-trifluoromethylbenzoic acid , 96% , 657-06-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB26.40 | In Stock |
|
| 5g | RMB53.60 | In Stock |
|
| 10g | RMB93.60 | In Stock |
|
| 25g | RMB127.20 | In Stock |
|
| 100g | RMB461.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-96 °C (lit.) |
| Boiling point: | 270.4±40.0 °C(Predicted) |
| Density | 1.523±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 2.45±0.25(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C8H4ClF3O2/c9-6-2-1-4(8(10,11)12)3-5(6)7(13)14/h1-3H,(H,13,14) |
| InChIKey | WLXRKCGYQAKHSJ-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(C(F)(F)F)=CC=C1Cl |
| CAS DataBase Reference | 657-06-7(CAS DataBase Reference) |
Description and Uses
2-Chloro-5-(trifluoromethyl)benzoic acid may be used as surrogate standard to investigate the pesticide exposure and home contamination in urine and hand wipe samples collected from farmers.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29163990 |
