BD0970832
1-Bromo-3-(tert-butyl)benzene , 98% , 3972-64-3
| Pack Size | Price | Stock | Quantity |
| 1g | RMB29.60 | In Stock |
|
| 5g | RMB122.40 | In Stock |
|
| 10g | RMB227.20 | In Stock |
|
| 25g | RMB512.80 | In Stock |
|
| 100g | RMB1783.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 23.51° C (Predicted) |
| Boiling point: | 95-97°C |
| Density | 1.251 g/cm3 |
| refractive index | 1.533 |
| storage temp. | Sealed in dry,Room Temperature |
| form | liquid |
| color | Clear, almost colourless |
| InChI | InChI=1S/C10H13Br/c1-10(2,3)8-5-4-6-9(11)7-8/h4-7H,1-3H3 |
| InChIKey | FDXXHPYFJDKWJS-UHFFFAOYSA-N |
| SMILES | C1(Br)=CC=CC(C(C)(C)C)=C1 |
Description and Uses
1-Bromo-3-tert-butylbenzene is a halogenated organic compound that can be used in substitution or cross-coupling reactions.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Warning |
| Hazard statements | H320 |
| Precautionary statements | P264-P337+P313-P305+P351+P338 |
| Hazard Codes | C |
| HS Code | 2903998090 |
