BD1113032
2,4-Dichloro-7-methoxyquinazoline , 95% , 62484-31-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB164.80 | In Stock |
|
| 250mg | RMB228.00 | In Stock |
|
| 1g | RMB643.20 | In Stock |
|
| 5g | RMB1925.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 121-121.5 °C |
| Boiling point: | 316 °C |
| Density | 1.450 |
| Flash point: | 145 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -0.26±0.30(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H6Cl2N2O/c1-14-5-2-3-6-7(4-5)12-9(11)13-8(6)10/h2-4H,1H3 |
| InChIKey | DJLGBZOLTZXCHN-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=CC(OC)=C2)=C(Cl)N=C1Cl |
Description and Uses
2,4-Dichloro-7-methoxyquinazoline is a useful reactant for the preparation of 2, 4-?diaminoquinazoline derivatives which is being study for a potential to be a potent PAK4 inhibitors.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HazardClass | IRRITANT |
