PRODUCT Properties
| Melting point: | 72-76 °C(lit.) |
| Boiling point: | 265.8±40.0 °C(Predicted) |
| Density | 1.238±0.06 g/cm3(Predicted) |
| pka | 1.41±0.12(Predicted) |
| InChI | 1S/C10H10F3NO/c1-14(2)8-5-3-7(4-6-8)9(15)10(11,12)13/h3-6H,1-2H3 |
| InChIKey | NDKSWWUQHXZADC-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(=O)C(F)(F)F |
Description and Uses
1-(4-Dimethylaminophenyl)-2,2,2-trifluoroethanone is an organic compound that is often used as a synthetic intermediate to synthesize organic compounds with specific functions, such as fluorescent dyes and biomarker molecules.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
