A3302212
2′,4′-Difluoroacetophenone , 98% , 364-83-0
CAS NO.:364-83-0
Empirical Formula: C8H6F2O
Molecular Weight: 156.13
MDL number: MFCD00151261
EINECS: 206-667-6
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 25G | RMB77.60 | In Stock |
|
| 10G | RMB89.60 | In Stock |
|
| 100G | RMB237.60 | In Stock |
|
| 50G | RMB258.40 | In Stock |
|
| 250g | RMB1068.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 80-81 °C25 mm Hg(lit.) |
| Density | 1.234 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 152 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.234 |
| color | Clear colorless to yellow |
| Water Solubility | INSOLUBLE |
| BRN | 1940741 |
| InChI | InChI=1S/C8H6F2O/c1-5(11)7-3-2-6(9)4-8(7)10/h2-4H,1H3 |
| InChIKey | QEWHNJPLPZOEKU-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(F)C=C1F)C |
| CAS DataBase Reference | 364-83-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-(2,4-difluorophenyl)-(364-83-0) |
| EPA Substance Registry System | Ethanone, 1-(2,4-difluorophenyl)- (364-83-0) |
Description and Uses
2′,4′-Difluoroacetophenone has been used as starting reagent in the synthesis of difluorinated chalcones.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29147090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






