BD1128332
2-Amino-2'-deoxyadenosine , 95% , 4546-70-7
CAS NO.:4546-70-7
Empirical Formula: C10H14N6O3
Molecular Weight: 266.26
MDL number: MFCD00047240
EINECS: 200-001-2
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB30.40 | In Stock |
|
| 1g | RMB80.00 | In Stock |
|
| 5g | RMB320.00 | In Stock |
|
| 25g | RMB1280.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 144°C |
| Boiling point: | 748.4±70.0 °C(Predicted) |
| Density | 2.08±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | DMSO (Slightly, Heated), Methanol (slightly, Heated), Water (Slightly, Sonicated) |
| pka | 13.79±0.60(Predicted) |
| form | Powder |
| color | White to Off-white |
| Major Application | pharmaceutical small molecule |
| InChI | InChI=1S/C10H14N6O3/c11-8-7-9(15-10(12)14-8)16(3-13-7)6-1-4(18)5(2-17)19-6/h3-6,17-18H,1-2H2,(H4,11,12,14,15)/t4-,5+,6+/m0/s1 |
| InChIKey | NOLHIMIFXOBLFF-KVQBGUIXSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3C(=C(N=C(N)N=3)N)N=C2)C[C@@H]1O |
Description and Uses
2,6-Diaminopurine-2’-deoxyriboside is a nucleoside analogs synthesized to interfere with DNA metabolism. A derivative of 2,6-Diaminopurine (D416580), which can be used as analyte for biological and analytical studies of incorporation of unnatural nucleotides into mutant tRNA and proteins.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| RTECS | UO7523300 |
| HS Code | 29389090 |





