BD1163648
Fmoc-Phe(2-NO2)-OH , 97% , 210282-30-7
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB261.60 | In Stock |
|
| 250mg | RMB392.00 | In Stock |
|
| 1g | RMB980.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 672.7±55.0 °C(Predicted) |
| Density | 1.371±0.06 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C |
| solubility | DMF (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | solid |
| pka | 3.58±0.11(Predicted) |
| Major Application | peptide synthesis |
| InChIKey | KVLRWXBYPKSBFY-NRFANRHFSA-N |
| SMILES | [N+](=O)([O-])c1c(cccc1)C[C@H](NC(=O)OCC2c3c(cccc3)c4c2cccc4)C(=O)O |
| CAS DataBase Reference | 210282-30-7(CAS DataBase Reference) |
Description and Uses
Fmoc-L-2-nitrophenylalanine can be useful in wavelength-selective uncaging of two different photoresponsive groups on one effector molecule for light-controlled activation and deactivation.
Safety
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2924297099 |
| Storage Class | 11 - Combustible Solids |






