PRODUCT Properties
| storage temp. | 2-8°C |
| form | solid |
| InChI | 1S/C14H12O2/c1-10-6-2-3-7-11(10)12-8-4-5-9-13(12)14(15)16/h2-9H,1H3,(H,15,16) |
| InChIKey | GOAWMKUDICJPHY-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=C(C=CC=C1)C2=CC=CC=C2C |
Description and Uses
2''-Methylbiphenyl-2-carboxylic Acid acts as a reagent in the preparation of orally active nonpeptide vasopressin V2 receptor antagonists, and also acts as an intermediate in varying organic synthetic processes.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H411 |
| Precautionary statements | P264-P270-P273-P280-P301+P312-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36-51 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Eye Irrit. 2 |

![2'-Methyl-[1,1'-biphenyl]-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/7111-77-5.gif)


![2'-(Hydroxymethyl)-[1,1'-biphenyl]-2-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/18773-63-2.gif)


![(S)-[1,1''-Binaphthalene]-2,2''-dicarboxylicacid](https://img.chemicalbook.com/CAS/GIF/18531-96-9.gif)
