BD1192148
2,4-Dichloro-1-(2-nitrovinyl)benzene , 95% , 18984-21-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB124.80 | In Stock |
|
| 1g | RMB336.80 | In Stock |
|
| 5g | RMB1076.00 | In Stock |
|
| 10g | RMB1828.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115-119 °C(lit.) |
| Boiling point: | 334.1±27.0 °C(Predicted) |
| Density | 1.447±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | solid |
| InChI | 1S/C8H5Cl2NO2/c9-7-2-1-6(8(10)5-7)3-4-11(12)13/h1-5H/b4-3+ |
| InChIKey | LIWIJBBAMBDXME-ONEGZZNKSA-N |
| SMILES | [H]\C(=C(\[H])[N+]([O-])=O)c1ccc(Cl)cc1Cl |
| CAS DataBase Reference | 18984-21-9(CAS DataBase Reference) |
Description and Uses
2,4-DICHLORO-OMEGA-NITROSTYRENE is used as an intermediate in the production of nucleic acid drugs, health foods, and biochemical reagents, and is also used in the manufacture of biochemical drugs such as adenosine triphosphate and cyclic adenosine monophosphate.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H319-H400 |
| Precautionary statements | P273-P301+P312+P330-P305+P351+P338 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,N,Xi |
| Risk Statements | 22-36-50/53 |
| Safety Statements | 26-36-60-61 |
| RIDADR | UN 3077 9/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2904990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Eye Irrit. 2 |
