BD1199232
2-Chloro-5-(trifluoromethyl)pyridine-4-carboxylic acid , 98% , 505084-58-2
CAS NO.：505084-58-2
Empirical Formula: C7H3ClF3NO2
Molecular Weight: 225.55
MDL number: MFCD01862019
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB28.80 | In Stock |
|
| 250mg | RMB36.00 | In Stock |
|
| 1g | RMB52.80 | In Stock |
|
| 5g | RMB197.60 | In Stock |
|
| 10g | RMB364.80 | In Stock |
|
| 25g | RMB785.60 | In Stock |
|
| 100g | RMB2896.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 185-186°C |
| Boiling point: | 376.7±42.0 °C(Predicted) |
| Density | 1.603±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | 2.05±0.36(Predicted) |
| form | Solid |
| Appearance | White to light yellow Solid |
| Water Solubility | Slightly soluble in water. |
| InChI | InChI=1S/C7H3ClF3NO2/c8-5-1-3(6(13)14)4(2-12-5)7(9,10)11/h1-2H,(H,13,14) |
| InChIKey | OIODRBHIESSYRO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=C(C(F)(F)F)C(C(O)=O)=C1 |
Description and Uses
It plays an important role for intermediate for pharmaceutical, organic synthesis and organic light-emitting diode(OLED).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| RIDADR | UN2811 |
| HS Code | 2933599590 |
