BD1333132
3,4-Dimethoxybenzyl Chloride , 95% , 7306-46-9
CAS NO.:7306-46-9
Empirical Formula: C9H11ClO2
Molecular Weight: 186.64
MDL number: MFCD00185554
EINECS: 230-756-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB124.00 | In Stock |
|
| 250mg | RMB182.40 | In Stock |
|
| 1g | RMB368.00 | In Stock |
|
| 5g | RMB1129.60 | In Stock |
|
| 25g | RMB3935.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 50-53 °C(lit.) |
| Boiling point: | 266.98°C (rough estimate) |
| Density | 1.1631 (rough estimate) |
| refractive index | 1.5080 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| Appearance | White to light yellow Solid |
| InChI | InChI=1S/C9H11ClO2/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5H,6H2,1-2H3 |
| InChIKey | WWHJLVMBXXXUFO-UHFFFAOYSA-N |
| SMILES | C1(OC)=CC=C(CCl)C=C1OC |
| CAS DataBase Reference | 7306-46-9(CAS DataBase Reference) |
Description and Uses
3,4-Dimethoxybenzyl chloride is an intermediate of tetrahydrobarmaline (tetrahydrobarmaline).
Safety
| Symbol(GHS) | ![]() ![]() GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H301-H311-H331-H341 |
| Precautionary statements | P201-P202-P261-P264-P270-P271-P280-P302+P352-P304+P340-P308+P313-P310-P330-P361-P403+P233-P405-P501 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 1759 8/PG 2 |
| RTECS | XS9060000 |
| HS Code | 2909309090 |







