BD1384032
                    3-(Bromomethyl)-3-methyloxetane , 97% , 78385-26-9
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB87.20 | In Stock | 
                                                 | 
                                        
| 5g | RMB332.00 | In Stock | 
                                                 | 
                                        
| 10g | RMB545.60 | In Stock | 
                                                 | 
                                        
| 25g | RMB1114.40 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Boiling point: | 162℃ | 
                                    
| Density | 1.438 | 
                                    
| refractive index | 1.4800 to 1.4840 | 
                                    
| Flash point: | 62℃ | 
                                    
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | 
                                    
| form | solid | 
                                    
| color | Colorless to Light yellow | 
                                    
| InChI | InChI=1S/C5H9BrO/c1-5(2-6)3-7-4-5/h2-4H2,1H3 | 
                                    
| InChIKey | MGBZKWOJRYGRTO-UHFFFAOYSA-N | 
                                    
| SMILES | O1CC(CBr)(C)C1 | 
                                    
| EPA Substance Registry System | Oxetane, 3-(bromomethyl)-3-methyl- (78385-26-9) | 
                                    
Description and Uses
3-(Bromomethyl)-3-methyloxetane is a monomer for the synthesis of Poly 3-bromomethyl-3-Me oxetane (PolyBrMMO), an energetic thermoplastic elastomer for propellant formulations.
Safety
| Symbol(GHS) | ![]() ![]() GHS08,GHS09  | 
                                    
| Signal word | Danger | 
| Hazard statements | H315-H334-H411 | 
| Precautionary statements | P501-P261-P273-P264-P280-P284-P302+P352-P391-P342+P311-P362+P364-P304+P340-P332+P313 | 
| Hazard Codes | Xn | 
| Risk Statements | 22 | 
| HS Code | 2932990090 | 




![[3-(bromomethyl)oxetan-3-yl]methanol](https://img.chemicalbook.com/CAS/GIF/22633-44-9.gif)

