BD1404232
2-Amino-9-((2R,3R,5S)-3-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-1H-purin-6(9H)-one , 95% , 3608-58-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB560.80 | In Stock |
|
| 250mg | RMB952.80 | In Stock |
|
| 1g | RMB2476.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <300℃ (water ) |
| Density | 2.08±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | 2-8°C(protect from light) |
| solubility | DMSO (Slightly), Water (Slightly, Heated, Sonicated) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C10H13N5O4/c11-10-13-7-6(8(18)14-10)12-3-15(7)9-5(17)1-4(2-16)19-9/h3-5,9,16-17H,1-2H2,(H3,11,13,14,18)/t4-,5+,9+/m0/s1 |
| InChIKey | OROIAVZITJBGSM-OBXARNEKSA-N |
| SMILES | OC[C@H]1O[C@@H](N2C3=C(C(NC(=N3)N)=O)N=C2)[C@H](O)C1 |
Description and Uses
3''-Deoxyguanosine is a ligand that can be complexed with enzymes, such as purine nucleoside phosphorylase, and receptors, in order to study structure-activity relationships. This compound can also be used to selectively impair transcription.
3’-Deoxyguanosine is a derivative of guanosine, a ligand which may be complexe with enzymes such as purine nucleoside phosphorylase and receptors. Potential anti-amoebic agent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 29349990 |
