BD1444948
9-Oxo-9H-fluorene-1-carboxylicacid , 98% , 1573-92-8
Synonym(s):
9-Oxo-1-fluorenecarboxylic acid
CAS NO.:1573-92-8
Empirical Formula: C14H8O3
Molecular Weight: 224.21
MDL number: MFCD00011537
EINECS: 216-396-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB213.60 | In Stock |
|
| 5g | RMB961.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 196-198 °C (lit.) |
| Boiling point: | 461.6±24.0 °C(Predicted) |
| Density | 1.424±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Methanol |
| pka | 3.48±0.20(Predicted) |
| form | Solid |
| color | Brown |
| InChI | 1S/C14H8O3/c15-13-10-5-2-1-4-8(10)9-6-3-7-11(12(9)13)14(16)17/h1-7H,(H,16,17) |
| InChIKey | CBEFMGJHEKAMNI-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cccc2-c3ccccc3C(=O)c12 |
| CAS DataBase Reference | 1573-92-8(CAS DataBase Reference) |
Description and Uses
9-Fluorenone-1-carboxylic acid was used in preparation of (E)- and (Z)-isomers of twisted 1,1′-dibromobifluorenylidene.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36/37/39-27 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |





![(2-Methyl-[1,1'-biphenyl]-3-yl)methanol](https://img.chemicalbook.com/CAS/GIF/76350-90-8.gif)
