BD1470932
4,5-Dichloro-2-methylpyridazin-3(2H)-one , 98% , 933-76-6
Synonym(s):
4,5-Dichloro-2-methylpyridazin-3-one
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB20.00 | In Stock |
|
| 1g | RMB24.00 | In Stock |
|
| 5g | RMB62.40 | In Stock |
|
| 10g | RMB108.80 | In Stock |
|
| 25g | RMB248.80 | In Stock |
|
| 100g | RMB863.20 | In Stock |
|
| 500g | RMB4256.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 87-91 °C(lit.) |
| Boiling point: | 197.2±50.0 °C(Predicted) |
| Density | 1.55±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Ethanol |
| form | powder to crystal |
| pka | -3.57±0.20(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C5H4Cl2N2O/c1-9-5(10)4(7)3(6)2-8-9/h2H,1H3 |
| InChIKey | ACKBTCUMGAHRIE-UHFFFAOYSA-N |
| SMILES | C1(=O)N(C)N=CC(Cl)=C1Cl |
Description and Uses
4,5-Dichloro-2-methyl-3(2H)-pyridazinone can be used in the synthesis of 4-amino-3(2H)-pyridazinones and 5-amino-3(2H)-pyridazinones via reaction with N-benzylaminoethanol.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H317-H319-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38-43 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | UR6188000 |
| HazardClass | 6.1 |
| HS Code | 29339980 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






