BD1472032
Prunetin , 99+% , 552-59-0
Synonym(s):
4′,5-Dihydroxy-7-methoxyisoflavone
CAS NO.:552-59-0
Empirical Formula: C16H12O5
Molecular Weight: 284.26
MDL number: MFCD00016951
EINECS: 209-018-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB136.00 | In Stock |
|
| 250mg | RMB230.40 | In Stock |
|
| 1g | RMB620.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-242°C |
| Boiling point: | 346.76°C (rough estimate) |
| Density | 1.2160 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Powder |
| pka | 6.35±0.20(Predicted) |
| color | White to off-white |
| BRN | 292155 |
| InChI | InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| InChIKey | KQMVAGISDHMXJJ-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(OC)=CC(O)=C2C(=O)C=1C1=CC=C(O)C=C1 |
| LogP | 3.530 (est) |
| CAS DataBase Reference | 552-59-0(CAS DataBase Reference) |
Description and Uses
Prunetin is isoflavone with diverse biological activities. Prunetin is an antagonist of the progesterone receptor when used at concentrations of 25 and 50 μM.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | DJ3100050 |
| F | 10 |
| Storage Class | 11 - Combustible Solids |






