BD1494732
H-Phe(4-NH2)-OH.HCl , 98% , 62040-55-5
CAS NO.：62040-55-5
Empirical Formula: C9H13ClN2O2
Molecular Weight: 216.66
MDL number: MFCD00012986
EINECS: 263-388-2
| Pack Size | Price | Stock | Quantity |
| 1g | RMB175.20 | In Stock |
|
| 5g | RMB558.40 | In Stock |
|
| 25g | RMB1668.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | 8.7 º (c=1% in 80% acetic acid) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Acetic Acid, Water |
| form | Powder |
| color | Off-White |
| optical activity | [α]20/D +8.7±0.5°, c = 1% in acetic acid: water (4:1) |
| BRN | 3657715 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H12N2O2.ClH/c10-7-3-1-6(2-4-7)5-8(11)9(12)13;/h1-4,8H,5,10-11H2,(H,12,13);1H/t8-;/m0./s1 |
| InChIKey | ISCZSPZLBJLJGO-QRPNPIFTSA-N |
| SMILES | Cl.N[C@@H](Cc1ccc(N)cc1)C(O)=O |
Description and Uses
p-Amino-L-phenylalanine is an analog of L-Phenylalanine (P319415).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10-23 |
| Storage Class | 11 - Combustible Solids |
