BD1510848
5-Benzyloxyindole-3-aceticacid , 98% , 4382-53-0
Synonym(s):
NSC 68361
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB237.60 | In Stock |
|
| 250mg | RMB397.60 | In Stock |
|
| 1g | RMB797.60 | In Stock |
|
| 5g | RMB2397.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 147-149 °C(Solv: ethanol, 50% (64-17-5)) |
| Boiling point: | 533.2±40.0 °C(Predicted) |
| Density | 1.314±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 4.51±0.30(Predicted) |
| form | crystalline |
| color | off-white to tan |
| InChI | 1S/C17H15NO3/c19-17(20)8-13-10-18-16-7-6-14(9-15(13)16)21-11-12-4-2-1-3-5-12/h1-7,9-10,18H,8,11H2,(H,19,20) |
| InChIKey | GKIOPUYLJUOZHJ-UHFFFAOYSA-N |
| SMILES | OC(=O)Cc1c[nH]c2ccc(OCc3ccccc3)cc12 |
| CAS DataBase Reference | 4382-53-0(CAS DataBase Reference) |
Description and Uses
5-Benzyloxyindole-3-acetic Acid can be used for biological study for molecular recognition of indole derivatives by polymers imprinted with indole-3-acetic acid.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| HS Code | 2933998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
