BD1529432
4-Chloro-6-iodoquinazoline , 95% , 98556-31-1
| Pack Size | Price | Stock | Quantity |
| 1g | RMB24.80 | In Stock |
|
| 5g | RMB64.80 | In Stock |
|
| 10g | RMB105.60 | In Stock |
|
| 25g | RMB258.40 | In Stock |
|
| 100g | RMB957.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175.0 to 179.0 °C |
| Boiling point: | 363.2±22.0 °C(Predicted) |
| Density | 2.017±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform (Slightly), Methanol (Slightly, Heated) |
| pka | 0.15±0.30(Predicted) |
| form | Solid |
| color | Light Brown to Dark Grey |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H4ClIN2/c9-8-6-3-5(10)1-2-7(6)11-4-12-8/h1-4H |
| InChIKey | BDAIUOPDSRAOKI-UHFFFAOYSA-N |
| SMILES | N1=C2C(C=C(I)C=C2)=C(Cl)N=C1 |
| CAS DataBase Reference | 98556-31-1(CAS DataBase Reference) |
Description and Uses
4-Chloro-6-iodoquinazoline is an intermediate in the synthesis of Lapatinib (L175800).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| HS Code | 2933599590 |
