BD1552832
2,3,4,5-Tetrafluoroaniline , 97% , 5580-80-3
CAS NO.:5580-80-3
Empirical Formula: C6H3F4N
Molecular Weight: 165.09
MDL number: MFCD00025153
EINECS: 276-218-7
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB32.00 | In Stock |
|
| 1g | RMB60.00 | In Stock |
|
| 5g | RMB227.20 | In Stock |
|
| 10g | RMB431.20 | In Stock |
|
| 25g | RMB992.80 | In Stock |
|
| 100g | RMB3534.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 27-29 °C(lit.) |
| Boiling point: | 78 °C13 mm Hg(lit.) |
| Density | 1.4700 (estimate) |
| refractive index | 1.4670 to 1.4710 |
| Flash point: | 175 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 1.23±0.10(Predicted) |
| form | Powder |
| color | White to brown |
| InChI | InChI=1S/C6H3F4N/c7-2-1-3(11)5(9)6(10)4(2)8/h1H,11H2 |
| InChIKey | BEECAQIHCYTZHC-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 5580-80-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenamine, 2,3,4,5-tetrafluoro-(5580-80-3) |
Description and Uses
2,3,4,5-Tetrafluoroaniline can be used as an intermediate in pharmaceuticals, pesticides, and liquid crystal materials.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H312-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,T |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-27-36/37/39 |
| RIDADR | 2810 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| HazardClass | IRRITANT, IRRITANT-HARMFUL |
| HazardClass | 6.1 |
| PackingGroup | Ⅲ |
| HS Code | 2921420090 |






