F865121
Pentafluorophenyl isothiocyanate , 96 , 35923-79-6
CAS NO.：35923-79-6
Empirical Formula: C7F5NS
Molecular Weight: 225.14
MDL number: MFCD00041042
EINECS: 252-791-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB1166.40 | In Stock |
|
| 5g | RMB3918.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 38-39 °C0.2 mm Hg(lit.) |
| Density | 1.594 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 109-110°C/35mm |
| storage temp. | 2-8°C |
| form | liquid |
| color | Clear, pale yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2736207 |
| InChI | 1S/C7F5NS/c8-2-3(9)5(11)7(13-1-14)6(12)4(2)10 |
| InChIKey | NGNKMRBGZPDABE-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(N=C=S)c(F)c1F |
| CAS DataBase Reference | 35923-79-6(CAS DataBase Reference) |
Description and Uses
Pentafluorophenyl isothiocyanate is used in the preparation of 5-isopropyl-3-pentafluorophenyl-2-thiohydantoin.
Safety
| Symbol(GHS) |   GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H312+H332-H315-H317-H319-H334-H335 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-42 |
| Safety Statements | 23-26-36/37-45 |
| RIDADR | UN 2206 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29309090 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Resp. Sens. 1 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |
