BD1560032
4-Oxoadamantane-1-carboxylic acid , 98% , 56674-87-4
| Pack Size | Price | Stock | Quantity |
| 1g | RMB34.40 | In Stock |
|
| 5g | RMB100.00 | In Stock |
|
| 10g | RMB193.60 | In Stock |
|
| 25g | RMB432.00 | In Stock |
|
| 100g | RMB1624.00 | In Stock |
|
| 500g | RMB7925.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 169.5-171.0 °C(Solv: ethyl ether (60-29-7)) |
| Boiling point: | 367.6±35.0 °C(Predicted) |
| Density | 1.358±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 4.45±0.20(Predicted) |
| Appearance | Off-white to light yellow Solid |
| InChI | InChI=1S/C11H14O3/c12-9-7-1-6-2-8(9)5-11(3-6,4-7)10(13)14/h6-8H,1-5H2,(H,13,14) |
| InChIKey | VFNJWHFPIRNNRQ-UHFFFAOYSA-N |
| SMILES | C12(C(O)=O)CC3CC(CC(C3=O)C1)C2 |
Description and Uses
2-Adamantanone-5-carboxylic Acid is a reactant used in the synthesis of potent inhibitors targeting the drug-resistant mutant of Influenze A. Starting material for Saxagliptin impurities.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| HazardClass | IRRITANT |
| HS Code | 2916399090 |
