BD1579032
3-(4-Nitrophenyl)acrylaldehyde , 98% , 1734-79-8
CAS NO.：1734-79-8
Empirical Formula: C9H7NO3
Molecular Weight: 177.16
MDL number: MFCD00007379
EINECS: 217-076-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB24.00 | In Stock |
|
| 1g | RMB63.20 | In Stock |
|
| 5g | RMB197.60 | In Stock |
|
| 10g | RMB364.00 | In Stock |
|
| 25g | RMB707.20 | In Stock |
|
| 100g | RMB2084.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-143 °C(lit.) |
| Boiling point: | 309.06°C (rough estimate) |
| Density | 1.3312 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | crystals |
| Appearance | Yellow to brown Solid |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 1565424 |
| InChI | 1S/C9H7NO3/c11-7-1-2-8-3-5-9(6-4-8)10(12)13/h1-7H/b2-1+ |
| InChIKey | ALGQVMMYDWQDEC-OWOJBTEDSA-N |
| SMILES | [O-][N+](=O)c1ccc(\C=C\C=O)cc1 |
| CAS DataBase Reference | 1734-79-8(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Propenal, 3-(4-nitrophenyl)- (1734-79-8) |
Description and Uses
Doebner-Miller reaction the 4- nitrocinnamaldehyde and 2-methylaniline in concentrated HC1 give the corresponding 8-methyl-2-phenylquinoline (3: R = 4'-N02) directly. The asymmetric Friedel-Crafts-type alkylation in aqueous media reaction of 4-Nitrocinnamaldehydr with N-methyl indole using trifluoroacetic acid (TFA) salt of the PEG-PS-supported prolyl peptide having the polyleucine tether as a catalyst. 4-Nitrocinnamaldehyde has been used in the preparation of 2, 2?-[(E)-3-(4-nitrophenyl) prop-2-ene-1,1-diyl] bis(3-hydroxy-5, 5-dimethylcyclohex-2-en-1-one).
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GD6650000 |
| TSCA | TSCA listed |
| HS Code | 29130000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
