PRODUCT Properties
| Melting point: | 86 °C |
| Boiling point: | 130 °C / 1mmHg |
| Density | 1.0182 (rough estimate) |
| refractive index | 1.5230 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 14.62±0.10(Predicted) |
| color | White to Almost white |
| InChI | 1S/C9H14O2/c10-4-8-6-1-2-7(3-6)9(8)5-11/h1-2,6-11H,3-5H2/t6-,7+,8-,9+ |
| InChIKey | IGHHPVIMEQGKNE-SPJNRGJMSA-N |
| SMILES | OC[C@@H]1[C@H]2C[C@H](C=C2)[C@@H]1CO |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2906.19.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






![Bicyclo[2.2.1]hept-2-ene](https://img.chemicalbook.com/CAS/GIF/498-66-8.gif)