BD1708348
Boc-Asn(Xan)-OH , 98% , 65420-40-8
Synonym(s):
Nα-t-Boc-Nγ-Xanthyl-L -asparagine;Nα-Boc-Nγ-(9-xanthenyl)-L -asparagine;Nα-Boc-Nγ-xanthyl-L -asparagine;Boc-Asn(Xan)-OH;N-α-t.-Boc-N-β-xanthyl-L-asparagine
| Pack Size | Price | Stock | Quantity |
| 5g | RMB134.40 | In Stock |
|
| 25g | RMB528.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 177.5-181.5 °C(lit.) |
| Boiling point: | 650.7±55.0 °C(Predicted) |
| Density | 1.32±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Solid |
| pka | 3.93±0.10(Predicted) |
| color | White to off-white |
| optical activity | [α]20/D +3°, c = 1 in acetone |
| BRN | 5172403 |
| Major Application | peptide synthesis |
| InChIKey | YMGDQLXBNMRJMR-HNNXBMFYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC(=O)NC1c2ccccc2Oc3ccccc13)C(O)=O |
| CAS DataBase Reference | 65420-40-8(CAS DataBase Reference) |
Description and Uses
Boc-Asn(Xan)-OH, is an Asparagine derivative, used in various chemical synthesis and biology studies.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29329990 |
| Storage Class | 13 - Non Combustible Solids |




