BD1723548
6-Nitro-4H-chromen-4-one , 98% , 51484-05-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB149.60 | In Stock |
|
| 5g | RMB584.00 | In Stock |
|
| 25g | RMB1943.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 172-175 °C (lit.) |
| Boiling point: | 347.1±42.0 °C(Predicted) |
| Density | 1.482±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | White to Yellow to Green |
| InChI | 1S/C9H5NO4/c11-8-3-4-14-9-2-1-6(10(12)13)5-7(8)9/h1-5H |
| InChIKey | ORWADBVBOPTYQT-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2OC=CC(=O)c2c1 |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xn |
| Risk Statements | 40 |
| Safety Statements | 22-36 |
| WGK Germany | 3 |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |




