BD1775448
N1-(7-Chloroquinolin-4-yl)ethane-1,2-diamine , 95% , 5407-57-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB317.60 | In Stock |
|
| 250mg | RMB476.00 | In Stock |
|
| 1g | RMB1192.00 | In Stock |
|
| 5g | RMB3570.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 137-139 °C |
| Boiling point: | 415.0±40.0 °C(Predicted) |
| Density | 1.316±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | Solid |
| pka | 9.11±0.10(Predicted) |
| color | White to off-white |
| InChI | InChI=1S/C11H12ClN3/c12-8-1-2-9-10(15-6-4-13)3-5-14-11(9)7-8/h1-3,5,7H,4,6,13H2,(H,14,15) |
| InChIKey | XBDASFGJHWAFFE-UHFFFAOYSA-N |
| SMILES | C(NC1C2C(N=CC=1)=CC(Cl)=CC=2)CN |
Description and Uses
Antimalarial agent 39 (compound 1) is an intermediate in the synthesis of antimalarial agents[1].
