BD1985448
2-(2,4-Difluorophenyl)-2-oxoacetaldehyde , 95% , 79784-36-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB3692.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 51-54°C |
| Boiling point: | 60-64 °C(Press: 4 Torr) |
| Density | 1.342±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | solid |
| Water Solubility | Soluble in water. |
| BRN | 4387465 |
| InChI | 1S/C8H4F2O2.H2O/c9-5-1-2-6(7(10)3-5)8(12)4-11;/h1-4H;1H2 |
| InChIKey | BILNRTMGRXGXSV-UHFFFAOYSA-N |
| SMILES | [H]O[H].FC1=C(C=CC(F)=C1)C(C([H])=O)=O |
| CAS DataBase Reference | 79784-36-4(CAS DataBase Reference) |
Description and Uses
Used in the synthesis of biologically active 1,2,4-triazine derivatives. Also used as pharmaceutical intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| HazardClass | IRRITANT |
| HS Code | 2912190090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |






