BD2066348
2-((2-Amino-4-chlorophenyl)amino)benzoicacid , 95+% , 67990-66-3
CAS NO.：67990-66-3
Empirical Formula: C13H11ClN2O2
Molecular Weight: 262.69
MDL number: MFCD00007775
| Pack Size | Price | Stock | Quantity |
| 25g | RMB873.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 191 °C (dec.)(lit.) |
| Boiling point: | 442.4±45.0 °C(Predicted) |
| Density | 1.441±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| pka | 3.60±0.36(Predicted) |
| InChI | 1S/C13H11ClN2O2/c14-8-5-6-12(10(15)7-8)16-11-4-2-1-3-9(11)13(17)18/h1-7,16H,15H2,(H,17,18) |
| InChIKey | HMVPMZFEYCGSTC-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)ccc1Nc2ccccc2C(O)=O |
Description and Uses
N-(2-Amino-4-chlorophenyl)anthranilic acid may be used in chemical synthesis studies.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
