BD2249248
(S)-2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid , 98% , 42438-90-4
Synonym(s):
(3S)-2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylic acid;L-1,2,3,4-Tetrahydronorharman-3-carboxylic acid;Lycoperodine-1
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB102.40 | In Stock |
|
| 250mg | RMB153.60 | In Stock |
|
| 1g | RMB384.00 | In Stock |
|
| 5g | RMB1344.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 289 °C (dec.)(lit.) |
| Boiling point: | 485.0±45.0 °C(Predicted) |
| Density | 1.377±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | soluble1.5mg/mL, clear (Solvent: 0.1N HCl:DMSO (1:1); warmed) |
| form | powder |
| pka | 2.28±0.20(Predicted) |
| color | white to beige |
| optical activity | [α]/D -57 to -67°, c = 1 (in MeOH:1N HCl (1:1)) |
| InChI | 1S/C12H12N2O2/c15-12(16)10-5-8-7-3-1-2-4-9(7)14-11(8)6-13-10/h1-4,10,13-14H,5-6H2,(H,15,16)/t10-/m0/s1 |
| InChIKey | FSNCEEGOMTYXKY-JTQLQIEISA-N |
| SMILES | O=C(O)[C@H]1NCC2=C(C3=C(N2)C=CC=C3)C1 |
| CAS DataBase Reference | 42438-90-4(CAS DataBase Reference) |
Description and Uses
Lycoperodine-1 (Cyclomethyltryptophan) is an active product that can be isolated from tomato fruits (Lycopersicon sculentum). Lycoperodine-1 act as an agonist of Ca2+ sensing receptors (CaSR)[1].
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |

![(S)-2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/42438-90-4.gif)

![(S)-2-(tert-butoxycarbonyl)-9-formyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/StructureFile/ChemBookStructure4/GIF/CB6348719.gif)
![(1S,3S)-1-ETHYL-2,3,4,9-TETRAHYDRO-1H-PYRIDO[3,4-B]INDOLE-3-CARBOXYLIC ACID](https://img.chemicalbook.com/CAS/GIF/134930-19-1.gif)
![(S)-2-(tert-Butoxycarbonyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/66863-43-2.gif)
![(S)-2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/204322-23-6.gif)