BD9425955
(S)-2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid , 98% , 204322-23-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB228.80 | In Stock |
|
| 5g | RMB799.20 | In Stock |
|
| 25g | RMB2715.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 702.4±60.0 °C(Predicted) |
| Density | 1.396±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| pka | 3.92±0.20(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | [α]20/D +56±2°, c = 1% in DMF |
| Major Application | peptide synthesis |
| InChIKey | IHHULIKSMJSELI-VWLOTQADSA-N |
| SMILES | OC(=O)[C@@H]1Cc2c(CN1C(=O)OCC3c4ccccc4-c5ccccc35)[nH]c6ccccc26 |
| CAS DataBase Reference | 204322-23-6(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H319-H302-H315 |
| Precautionary statements | P264-P270-P301+P312-P330-P501-P264-P280-P305+P351+P338-P337+P313P-P264-P280-P302+P352-P321-P332+P313-P362 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 13 - Non Combustible Solids |

![(S)-2-(((9H-Fluoren-9-yl)methoxy)carbonyl)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/204322-23-6.gif)



![(S)-2,3,4,9-Tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylicacid](https://img.chemicalbook.com/CAS/GIF/42438-90-4.gif)
