PRODUCT Properties
| Melting point: | 205-208 °C(lit.) |
| Boiling point: | 476.7±38.0 °C(Predicted) |
| Density | 1.540±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Decomposes in contact with water,Insoluble in water |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 2222668 |
| InChI | 1S/C12H8Cl2O4S2/c13-19(15,16)11-5-1-9(2-6-11)10-3-7-12(8-4-10)20(14,17)18/h1-8H |
| InChIKey | OTFAWEIFBPUXOH-UHFFFAOYSA-N |
| SMILES | ClS(=O)(=O)c1ccc(cc1)-c2ccc(cc2)S(Cl)(=O)=O |
| CAS DataBase Reference | 3406-84-6(CAS DataBase Reference) |
| EPA Substance Registry System | [1,1'-Biphenyl]-4,4'-disulfonyl dichloride (3406-84-6) |
Description and Uses
Biphenyl-4,4′-disulfonyl chloride was used in the synthesis of 6A,6D-diamino-6A,6D-dideoxy-β-cyclodextrin.
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29049090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
