BD2713745
2-Methylfuran-3-carboxylicacid , 97% , 6947-94-0
CAS NO.:6947-94-0
Empirical Formula: C6H6O3
Molecular Weight: 126.11
MDL number: MFCD00092314
EINECS: 614-978-7
| Pack Size | Price | Stock | Quantity |
| 1g | RMB44.00 | In Stock |
|
| 5g | RMB142.40 | In Stock |
|
| 25g | RMB623.20 | In Stock |
|
| 100g | RMB2379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 99-103 °C |
| Boiling point: | 174.21°C (rough estimate) |
| Density | 1.2048 (rough estimate) |
| refractive index | 1.4189 (estimate) |
| storage temp. | 2-8°C |
| form | powder |
| pka | 4.37±0.20(Predicted) |
| Appearance | Light brown to brown Solid |
| BRN | 112229 |
| InChI | InChI=1S/C6H6O3/c1-4-5(6(7)8)2-3-9-4/h2-3H,1H3,(H,7,8) |
| InChIKey | CFGQZVOVFIZRMN-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(O)=O)=C1C |
| CAS DataBase Reference | 6947-94-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P405-P501a-P280-P305+P351+P338-P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 45-36/37/39-26 |
| RIDADR | UN 3261 8/PG 3 |
| WGK Germany | 3 |
| HazardClass | 8 |
| HS Code | 29321900 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |







