BD2834945
Ethyl4-methylpent-4-enoate , 96% , 4911-54-0
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB60.80 | In Stock |
|
| 250mg | RMB103.20 | In Stock |
|
| 1g | RMB293.60 | In Stock |
|
| 5g | RMB1178.40 | In Stock |
|
| 10g | RMB2161.60 | In Stock |
|
| 25g | RMB4379.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | -65.52°C (estimate) |
| Boiling point: | 85 °C/20 mmHg (lit.) |
| Density | 0.891 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 136 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C8H14O2/c1-4-10-8(9)6-5-7(2)3/h2,4-6H2,1,3H3 |
| InChIKey | RRTBSPBUHUUTHR-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CCC(C)=C |
| CAS DataBase Reference | 4911-54-0 |
Description and Uses
Ethyl 4-methyl-4-pentenoate is an olefin ester. It undergoes iron carbonyl-promoted isomerization to α,β-unsaturated esters. Reaction of ethyl 4-methyl-4-pentenoate with CH3OBOCH3+ was examined in a small Fourier-transform ion cyclotron resonance mass spectrometer equipped with a permanent magnet.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H225 |
| Precautionary statements | P210-P403+P235 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 24/25 |
| RIDADR | UN 3272 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29161900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




