BD2835045
Boc-Val-Gly-OH , 98% , 45233-75-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB62.40 | In Stock |
|
| 5g | RMB234.40 | In Stock |
|
| 25g | RMB1104.80 | In Stock |
|
| 100g | RMB3369.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 100-110°C |
| Boiling point: | 491.2±30.0 °C(Predicted) |
| Density | 1.141±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| form | Solid |
| pka | 3.40±0.10(Predicted) |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C12H22N2O5/c1-7(2)9(10(17)13-6-8(15)16)14-11(18)19-12(3,4)5/h7,9H,6H2,1-5H3,(H,13,17)(H,14,18)(H,15,16)/t9-/m0/s1 |
| InChIKey | BWPKSNMGVTYXQQ-VIFPVBQESA-N |
| SMILES | O=C(O)CNC([C@H](C(C)C)NC(OC(C)(C)C)=O)=O |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| Storage Class | 11 - Combustible Solids |
