BD8875731
Boc-Val-Val , 95% , 69209-73-0
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB42.40 | In Stock |
|
| 1g | RMB88.00 | In Stock |
|
| 5g | RMB356.00 | In Stock |
|
| 25g | RMB1568.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 506.3±35.0 °C(Predicted) |
| Density | 1.088±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| pka | 3.44±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| InChI | 1S/C15H28N2O5/c1-8(2)10(17-14(21)22-15(5,6)7)12(18)16-11(9(3)4)13(19)20/h8-11H,1-7H3,(H,16,18)(H,17,21)(H,19,20)/t10-,11-/m0/s1 |
| InChIKey | IBABAURSJXMCQJ-QWRGUYRKSA-N |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C)C(O)=O |
Description and Uses
(tert-Butoxycarbonyl)-L-valyl-L-valine is a valine derivative[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| WGK Germany | WGK 3 |
| Storage Class | 11 - Combustible Solids |
