BD2848445
(SP,S'P)-1,1'-Bis[bis(4-methoxy-3,5-dimethylphenyl)phosphino]-2,2'-bis[(R)-α-(dimethylamino)benzyl]ferrocene , 98% , 494227-37-1
Synonym(s):
(1R,1′R)- 1,1′-Bis[bis(4-methoxy-3,5-dimethylphenyl)phosphino]-2,2′-bis[(R)-(dimethylamino)phenylmethyl]ferrocene (acc to CAS);Mandyphos SL-M004-1
CAS NO.:494227-37-1
Empirical Formula: C64H74FeN2O4P210*
Molecular Weight: 1053.08
MDL number: MFCD04117704
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB236.00 | In Stock |
|
| 250mg | RMB516.00 | In Stock |
|
| 1g | RMB1581.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| alpha | -61.5° (c 1.0, CHCl3) |
| form | solid |
| color | yellow to orange-red |
| Stability: | store cold |
| InChIKey | HEJIDMKBSDYNOY-FHGINWLJNA-N |
| SMILES | [Fe].COc1c(C)cc(cc1C)P([C]2[CH][CH][CH][C]2[C@H](N(C)C)c3ccccc3)c4cc(C)c(OC)c(C)c4.COc5c(C)cc(cc5C)P([C]6[CH][CH][CH][C]6[C@H](N(C)C)c7ccccc7)c8cc(C)c(OC)c(C)c8 |
Description and Uses
It may be used as a chiral ligand in the rhodium complex-catalyzed hydrogenation reaction, a key step during the synthesis of argatroban.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |

![(SP,S'P)-1,1'-Bis[bis(4-methoxy-3,5-dimethylphenyl)phosphino]-2,2'-bis[(R)-α-(dimethylamino)benzyl]ferrocene](https://img.chemicalbook.com/CAS/GIF/494227-37-1.gif)


![(S,S)-(-)-2,2'-Bis[(R)-(N,N-dimethylamino)(phenyl)methyl]-1,1'-bis[di(3,5-trifluoromethylphenyl)phosphino]ferrocene](https://img.chemicalbook.com/CAS/GIF/494227-36-0.gif)

![(R)-N,N-Dimethyl-1-[(S)-1′,2-bis(diphenylphosphino)ferrocenyl]ethylamine](https://img.chemicalbook.com/CAS/GIF/74311-56-1.gif)