BD2855845
Ethyl2-chloro-3-oxopropanoate , 95% , 33142-21-1
CAS NO.：33142-21-1
Empirical Formula: C5H7ClO3
Molecular Weight: 150.56
MDL number: MFCD07369378
EINECS: 251-390-6
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB52.00 | In Stock |
|
| 1g | RMB142.40 | In Stock |
|
| 5g | RMB456.00 | In Stock |
|
| 10g | RMB888.00 | In Stock |
|
| 25g | RMB2155.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 88-90 °C(Solv: benzene (71-43-2)) |
| Boiling point: | 68-70 °C(Press: 20 Torr) |
| Density | 1.217±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Chloroform, Dichloromethane |
| form | low melting solid |
| pka | 4.09±0.29(Predicted) |
| Appearance | White to off-white Solid |
| Stability: | Store FROZEN |
| InChI | InChI=1S/C5H7ClO3/c1-2-9-5(8)4(6)3-7/h3-4H,2H2,1H3 |
| InChIKey | DWXKSCKBUSAOKS-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)C(Cl)C=O |
| CAS DataBase Reference | 33142-21-1 |
Description and Uses
Material that was assayed to be approximately 80% pure was diluted to 5% in benzene.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335 |
| Precautionary statements | P280 |
| HS Code | 2918300090 |
