BD2878045
2-Chloro-4-iodonicotinicacid , 98% , 544671-78-5
Synonym(s):
2-Chloro-4-iodonicotinic acid
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB96.00 | In Stock |
|
| 1g | RMB234.40 | In Stock |
|
| 5g | RMB767.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 175-178°C (dec.) |
| Boiling point: | 369.3±42.0 °C(Predicted) |
| Density | 2.193±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| pka | 0.73±0.25(Predicted) |
| Appearance | Off-white to light yellow Solid |
| Sensitive | Light Sensitive |
| InChI | InChI=1S/C6H3ClINO2/c7-5-4(6(10)11)3(8)1-2-9-5/h1-2H,(H,10,11) |
| InChIKey | XOMBFOCJXYZRSI-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(I)=C1C(O)=O |
Description and Uses
2-Chloro-4-iodonicotinic acid is used as a pharmaceutical intermediates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
