BD2935345
5-Chloro-8-nitroquinoline , 95+% , 6942-98-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB93.60 | In Stock |
|
| 250mg | RMB179.20 | In Stock |
|
| 1g | RMB523.20 | In Stock |
|
| 5g | RMB1828.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 136-136.5℃ |
| Boiling point: | 353.6±27.0 °C(Predicted) |
| Density | 1.484±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 0.12±0.29(Predicted) |
| Appearance | Light yellow to yellow Solid |
| InChI | InChI=1S/C9H5ClN2O2/c10-7-3-4-8(12(13)14)9-6(7)2-1-5-11-9/h1-5H |
| InChIKey | DHRPLGHWWKFRKY-UHFFFAOYSA-N |
| SMILES | N1C2C(=C(Cl)C=CC=2[N+]([O-])=O)C=CC=1 |
Description and Uses
5-Chloro-8-nitroquinoline itself is not typically used as a final product; its core value lies in its role as a pharmaceutical intermediate. Its primary use is in the synthesis of bioactive molecules, particularly antimalarial drugs.





