A6200312
8-Nitroquinoline , 98% , 607-35-2
CAS NO.:607-35-2
Empirical Formula: C9H6N2O2
Molecular Weight: 174.16
MDL number: MFCD00006806
EINECS: 210-135-9
| Pack Size | Price | Stock | Quantity |
| 1g | RMB25.60 | In Stock |
|
| 5G | RMB92.00 | In Stock |
|
| 25G | RMB401.60 | In Stock |
|
| 100G | RMB575.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 89-91 °C (lit.) |
| Boiling point: | 305.12°C (rough estimate) |
| Density | 1.2190 (estimate) |
| refractive index | 1.6820 (rough estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 1.20±0.17(Predicted) |
| form | powder to crystal |
| color | Monoclinic crystals from alcohol |
| Water Solubility | Soluble in ethanol, ethyl ether and benzene, slightly soluble in cold water. |
| BRN | 135178 |
| InChI | InChI=1S/C9H6N2O2/c12-11(13)8-5-1-3-7-4-2-6-10-9(7)8/h1-6H |
| InChIKey | OQHHSGRZCKGLCY-UHFFFAOYSA-N |
| SMILES | N1C2C(=CC=CC=2[N+]([O-])=O)C=CC=1 |
| CAS DataBase Reference | 607-35-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 8-Nitro quinoline(607-35-2) |
| EPA Substance Registry System | Quinoline, 8-nitro- (607-35-2) |
Description and Uses
8-Nitroquinoline was used to prepare furazano [3,4-h] quinoline. It was also used to synthesize corresponding 2-substituted phenoxy-6-methoxy-8-aminoquinoline.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319-H335-H351 |
| Precautionary statements | P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338-P308+P313 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38-40-68 |
| Safety Statements | 26-27-36/37/39-36 |
| WGK Germany | 3 |
| RTECS | VC1925000 |
| Hazard Note | Harmful/Irritant |
| TSCA | TSCA listed |
| HS Code | 29334900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Hazardous Substances Data | 607-35-2(Hazardous Substances Data) |
| Toxicity | TD orl-rat: 36,400 mg/kg/2Y-C:CAR,REP CALEDQ14,115,81 |







