BD2937845
(S)-Bis((S)-1-phenylethyl)aminehydrochloride , 98% , 40648-92-8
Synonym(s):
(−)-Bis[(S)-α-methylbenzyl]amine hydrochloride
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB38.40 | In Stock |
|
| 1g | RMB124.00 | In Stock |
|
| 5g | RMB466.40 | In Stock |
|
| 25g | RMB2056.80 | In Stock |
|
| 100g | RMB6811.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261-263 °C(lit.) |
| refractive index | -73 ° (C=3, EtOH) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| optical activity | [α]20/D 73±2°, c = 3% in ethanol |
| BRN | 4723969 |
| InChI | InChI=1/C16H19N.ClH/c1-13(15-9-5-3-6-10-15)17-14(2)16-11-7-4-8-12-16;/h3-14,17H,1-2H3;1H/t13-,14-;/s3 |
| InChIKey | ZBQCLJZOKDRAOW-FGVWXQOBNA-N |
| SMILES | C1(=CC=CC=C1)[C@H](C)N[C@@H](C)C1=CC=CC=C1.Cl |&1:6,9,r| |
Description and Uses
()-Bis[(S)-1-phenylethyl]amine hydrochloride can be used:
- To prepare phosphoramidite (Feringa) ligand named (R)-2,2′-binaphthoyl-(S,S)-di-(1-phenylethyl)aminoylphosphine.
- As a chiral amphiphilic cation to encapsulate polyoxometalates, which act as supramolecular assemblies employed in the asymmetric oxidation of sulfides.
- As a chiral shift agent in the determination of enantiomeric purity of tris(tetrachlorobenzenediolato) phosphate(V) anion using 31P NMR.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-36-36/37/39 |
| WGK Germany | 3 |
| F | 3 |
| HS Code | 2921.49.5000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |





![N-Benzylcinchoninium Chloride [Chiral Phase-Transfer Catalyst]](https://img.chemicalbook.com/CAS/GIF/69221-14-3.gif)

