BD2946645
6,6'-Dibromo-2,2'-bipyridine , 97% , 49669-22-9
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB141.60 | In Stock |
|
| 250mg | RMB214.40 | In Stock |
|
| 1g | RMB595.20 | In Stock |
|
| 5g | RMB1906.40 | In Stock |
|
| 25g | RMB5696.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 220-223 °C(lit.) |
| Boiling point: | 369.4±37.0 °C(Predicted) |
| Density | 1.809±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -0.44±0.22(Predicted) |
| form | powder to crystal |
| color | White to Light yellow |
| λmax | 304nm(EtOH)(lit.) |
| InChI | InChI=1S/C10H6Br2N2/c11-9-5-1-3-7(13-9)8-4-2-6-10(12)14-8/h1-6H |
| InChIKey | WZVWSOXTTOJQQQ-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(Br)=CC=C2)=NC(Br)=CC=C1 |
Description and Uses
6,6''-Dibromo-2,2''-bipyridine is used as a catalyst for the preparation of iodoesters through copper-catalyzed [2,3]-and [1,2]-rearrangements of diazoesters and allylic iodides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29333990 |
![[2,2'-Bipyridine]-6,6'-diamine](https://img.chemicalbook.com/CAS/GIF/93127-75-4.gif)
