![[2,2'-Bipyridine]-6,6'-diamine](https://img.chemicalbook.com/CAS/GIF/93127-75-4.gif)
BD5141241
[2,2'-Bipyridine]-6,6'-diamine , 98% , 93127-75-4
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB342.40 | In Stock |
|
| 250mg | RMB488.80 | In Stock |
|
| 1g | RMB1299.20 | In Stock |
|
| 5g | RMB4556.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186 °C |
| Boiling point: | 445.9±45.0 °C(Predicted) |
| Density | 1.277±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 5.91±0.34(Predicted) |
| color | White to Yellow to Green |
| InChI | InChI=1S/C10H10N4/c11-9-5-1-3-7(13-9)8-4-2-6-10(12)14-8/h1-6H,(H2,11,13)(H2,12,14) |
| InChIKey | YKSWVQYWQSZDPR-UHFFFAOYSA-N |
| SMILES | C1(C2=NC(N)=CC=C2)=NC(N)=CC=C1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332-H315-H319 |
| Precautionary statements | P261-P264-P270-P271-P280-P301+P312+P330-P302+P352+P312+P362+P364-P304+P340+P312-P305+P351+P338+P337+P313-P501 |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37/39 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
