BD3063545
2-Amino-4-(methylsulfonyl)benzoicacid , 95% , 393085-45-5
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB217.60 | In Stock |
|
| 250mg | RMB384.00 | In Stock |
|
| 1g | RMB740.00 | In Stock |
|
| 5g | RMB2846.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245°C |
| Boiling point: | 493.5±45.0 °C(Predicted) |
| Density | 1.473±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 4.24±0.10(Predicted) |
| form | solid |
| color | White |
| Stability: | Hygroscopic |
| InChI | 1S/C8H9NO4S/c1-14(12,13)5-2-3-6(8(10)11)7(9)4-5/h2-4H,9H2,1H3,(H,10,11) |
| InChIKey | KFOGGDGNOLZBNY-UHFFFAOYSA-N |
| SMILES | [S](=O)(=O)(C)c1cc(c(cc1)C(=O)O)N |
Description and Uses
2-Amino-4-(methylsulfonyl)benzoic Acid is a reagent used in the synthesis of anthranilic diamides containing fluorinated groups as potential ryanodine receptors activators.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| Hazard Codes | Xi |
| WGK Germany | WGK 3 |
| HS Code | 2922498590 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Chronic 3 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
