A6015512
4-(Methylsulfonyl)-2-nitrobenzoic acid , 98% , 110964-79-9
CAS NO.:110964-79-9
Empirical Formula: C8H7NO6S
Molecular Weight: 245.21
MDL number: MFCD01941299
EINECS: 601-017-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB38.40 | In Stock |
|
| 25g | RMB76.00 | In Stock |
|
| 100g | RMB225.60 | In Stock |
|
| 500g | RMB837.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-212 |
| Boiling point: | 497.8±45.0 °C(Predicted) |
| Density | 1.576 |
| vapor pressure | 0Pa at 25℃ |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 1.51±0.25(Predicted) |
| color | Pale Yellow |
| InChI | InChI=1S/C8H7NO6S/c1-16(14,15)5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11) |
| InChIKey | QNOUABMNRMROSL-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=C(S(C)(=O)=O)C=C1[N+]([O-])=O |
| LogP | -0.52 at 22℃ and pH2.4-2.8 |
| Surface tension | 72.7mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 110964-79-9(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4-(methylsulfonyl)-2-nitro- (110964-79-9) |
Description and Uses
4-Methylsulfonyl-2-nitrobenzoic acid is a metabolite of Mesotrione.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2916399090 |





