BD3068245
Fmoc-D-Tle-OH , 98% , 198543-64-5
Synonym(s):
Fmoc-D-α-t-butylglycine;N-α-Fmoc-D-α-t.-butyl-glycine, N-α-Fmoc-D-t-leucine
| Pack Size | Price | Stock | Quantity |
| 1g | RMB72.00 | In Stock |
|
| 5g | RMB236.80 | In Stock |
|
| 25g | RMB912.80 | In Stock |
|
| 100g | RMB2125.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-130°C |
| Boiling point: | 554.1±33.0 °C(Predicted) |
| Density | 1.209±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| form | powder |
| pka | 3.92±0.10(Predicted) |
| color | White to off-white |
| Major Application | peptide synthesis |
| InChI | 1S/C21H23NO4/c1-21(2,3)18(19(23)24)22-20(25)26-12-17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)17/h4-11,17-18H,12H2,1-3H3,(H,22,25)(H,23,24)/t18-/m0/s1 |
| InChIKey | VZOHGJIGTNUNNC-SFHVURJKSA-N |
| SMILES | N([C@H](C(C)(C)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H320-H335 |
| Precautionary statements | P264-P270-P301+P312-P330 |
| WGK Germany | WGK 2 water endangering |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |
