BD3075545
1-(1H-Indol-5-yl)ethanone , 97% , 53330-94-2
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB121.60 | In Stock |
|
| 250mg | RMB227.20 | In Stock |
|
| 1g | RMB547.20 | In Stock |
|
| 5g | RMB1952.80 | In Stock |
|
| 25g | RMB6664.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-96°C |
| Boiling point: | 284.68°C (rough estimate) |
| Density | 1.1202 (rough estimate) |
| refractive index | 1.5460 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 16.06±0.30(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C10H9NO/c1-7(12)8-2-3-10-9(6-8)4-5-11-10/h2-6,11H,1H3 |
| InChIKey | GOFIUEUUROFVMA-UHFFFAOYSA-N |
| SMILES | C(=O)(C1C=CC2=C(C=1)C=CN2)C |
| CAS DataBase Reference | 53330-94-2(CAS DataBase Reference) |
Description and Uses
5-Acetylindole, is a building block used in various chemical synthesis.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| HS Code | 2933998090 |
