BD3087657
Bis(3,5-bis(trifluoromethyl)phenyl)chlorophosphane , 98% , 142421-57-6
Synonym(s):
P,P-Bis[3,5-bis(trifluoromethyl)phenyl]phosphinous chloride
CAS NO.：142421-57-6
Empirical Formula: C16H6ClF12P
Molecular Weight: 492.63
MDL number: MFCD01630852
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB108.00 | In Stock |
|
| 250mg | RMB182.40 | In Stock |
|
| 1g | RMB490.40 | In Stock |
|
| 5g | RMB1714.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25-29 °C |
| Boiling point: | 333.2±42.0 °C(Predicted) |
| form | liquid |
| color | colorless |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C16H6ClF12P/c17-30(11-3-7(13(18,19)20)1-8(4-11)14(21,22)23)12-5-9(15(24,25)26)2-10(6-12)16(27,28)29/h1-6H |
| InChIKey | DFZQEHBNAJGDCT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cc(cc(c1)C(F)(F)F)P(Cl)c2cc(cc(c2)C(F)(F)F)C(F)(F)F |
Description and Uses
Chlorobis[3,5-bis(trifluoromethyl)phenyl]phosphine is used as a reactant for the synthesis of chiral phosphine-aminophosphine ligands for rhodium-catalyzed asymmetric hydrogenation, ligands for palladium-catalyzed stereoselective allylation reactions, enantioselective hydrogenations, Josiphos analog as catalyst for asymmetric hydrogenation, ligands used in asymmetric hydrovinylation reactions.
Safety
| Symbol(GHS) |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H261-H314 |
| Precautionary statements | P231+P232-P280-P305+P351+P338-P310-P422 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 14-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN3265 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 4.3 - Hazardous materials which set free flammable gases upon contact with water |
| Hazard Classifications | Skin Corr. 1B Water-react 3 |
