BD8995255
Bis(3,5-dimethylphenyl)chlorophosphine , 98+% , 74289-57-9
Synonym(s):
Bis(3,5-dimethylphenyl)phosphinous chloride;Chlorobis(3,5-dimethylphenyl)phosphine
CAS NO.：74289-57-9
Empirical Formula: C16H18ClP
Molecular Weight: 276.74
MDL number: MFCD01630841
EINECS: 636-136-8
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB194.40 | In Stock |
|
| 250mg | RMB329.60 | In Stock |
|
| 1g | RMB888.00 | In Stock |
|
| 5g | RMB3172.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 115-135 °C(Press: 0.015 Torr) |
| Density | 1.102 g/mL at 25 °C |
| refractive index | n20/D 1.606 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C16H18ClP/c1-11-5-12(2)8-15(7-11)18(17)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | FCEBDAANWYNQMO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(c1)P(Cl)c2cc(C)cc(C)c2 |
Description and Uses
Chlorobis(3,5-dimethylphenyl)phosphine is used in the synthesis of (S)- and (R)-2,2-Bis[bis(3,5-dimethylphenyl)phosphinoyl]-5,5,6,6,7,7,8,8-octahydro-1,1-binaphthyl (Xyl-H 8 -BINAPO).
Safety
| Symbol(GHS) |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314-H318 |
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 |
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |
